Introduction：Basic information about CAS 2607-52-5|2,6-ditert-butyl-4-methylidenecyclohexa-2,5-dien-1-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-ditert-butyl-4-methylidenecyclohexa-2,5-dien-1-one |
|---|
| CAS Number | 2607-52-5 | Molecular Weight | 218.33500 |
|---|
| Density | 0.92g/cm3 | Boiling Point | 306.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H22O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 125.4ºC |
|---|
Names
| Name | 2,6-ditert-butyl-4-methylidenecyclohexa-2,5-dien-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.92g/cm3 |
|---|
| Boiling Point | 306.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H22O |
|---|
| Molecular Weight | 218.33500 |
|---|
| Flash Point | 125.4ºC |
|---|
| Exact Mass | 218.16700 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.07030 |
|---|
| Vapour Pressure | 0.000789mmHg at 25°C |
|---|
| Index of Refraction | 1.49 |
|---|
| InChIKey | JJQCWPWUHZFKBN-UHFFFAOYSA-N |
|---|
| SMILES | C=C1C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1 |
|---|
Safety Information
Customs
| HS Code | 2914299000 |
|---|
| Summary | 2914299000. other cyclanic, cyclenic or cyclotherpenic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| 2,6-Di-tert-butyl-4-methylene-2,5-cyclohexadiene-1-one |
| Bht-quinone methide |
| 3,5-di-tert-butyl-4-quinomethide |
| 2,6-Di-t-butyl-4-methylene-2,5-cyclohexadienone |
| 2,6-di-tert-butyl-4-methylene-2,5-cyclohexadien-1-one |
| 2,6-di-t-Butyl-4-methylene-2,5-cyclohexadiene-1-one |
| Bht-QM |
| 2,6-di-tert-butyl-4-methylenecyclohexa-2,5-dienone |
| 2,6-Di-tert-butyl-4-methylene-2,5-cyclohexadienone |
| Everolimus Impurity 14 |
