Introduction：Basic information about CAS 20674-98-0|2,3,4,5-Tetrahydro-2-isobutyl-8-methyl-5-[2-(6-methyl-3-pyridyl)ethyl]-1H-pyrido[4,3-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,4,5-Tetrahydro-2-isobutyl-8-methyl-5-[2-(6-methyl-3-pyridyl)ethyl]-1H-pyrido[4,3-b]indole |
|---|
| CAS Number | 20674-98-0 | Molecular Weight | 361.52300 |
|---|
| Density | 1.1g/cm3 | Boiling Point | 531.9ºC at 760 mmHg |
|---|
| Molecular Formula | C24H31N3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 275.5ºC |
|---|
Names
| Name | 8-methyl-2-(2-methylpropyl)-5-[2-(6-methylpyridin-3-yl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|
Chemical & Physical Properties
| Density | 1.1g/cm3 |
|---|
| Boiling Point | 531.9ºC at 760 mmHg |
|---|
| Molecular Formula | C24H31N3 |
|---|
| Molecular Weight | 361.52300 |
|---|
| Flash Point | 275.5ºC |
|---|
| Exact Mass | 361.25200 |
|---|
| PSA | 21.06000 |
|---|
| LogP | 4.84780 |
|---|
| Vapour Pressure | 2.15E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.607 |
|---|
| InChIKey | KNMOCSZJXJVVTK-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc2c(c1)c1c(n2CCc2ccc(C)nc2)CCN(CC(C)C)C1 |
|---|
