Introduction:Basic information about CAS 114772-38-2|Methyl α-bromo-2-(p-tolyl)benzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl α-bromo-2-(p-tolyl)benzoate |
|---|
| CAS Number | 114772-38-2 | Molecular Weight | 305.167 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 412.8±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H13BrO2 | Melting Point | 56 °C |
|---|
| MSDS | / | Flash Point | 203.5±26.8 °C |
|---|
Names
| Name | Methyl 4'-bromomethyl biphenyl-2-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 412.8±38.0 °C at 760 mmHg |
|---|
| Melting Point | 56 °C |
|---|
| Molecular Formula | C15H13BrO2 |
|---|
| Molecular Weight | 305.167 |
|---|
| Flash Point | 203.5±26.8 °C |
|---|
| Exact Mass | 304.009888 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 4.35 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | RMXGTMRDXKUUDJ-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccccc1-c1ccc(CBr)cc1 |
|---|
| Storage condition | -20°C Freezer, Under Inert Atmosphere |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| METHYL 4'-BROMOMETHYL-2-BIPHENYLCARBOXYLATE |
| Methyl 4'-(bromomethyl)-2-biphenylcarboxylate |
| 2-[4-(Bromomethyl)phenyl]benzoic Acid Methyl Ester |
| Methyl 4'-(bromomethyl)biphenyl-2-carboxylate |
| Methyl 4'-(bromomethyl)-[1,1'-biphenyl]-2-carboxylate |
| Methyl α-bromo-2-(p-tolyl)benzoate |
| 4'-(Bromomethyl)biphenyl-2-carboxylic Acid Methyl Ester |
| [1,1'-Biphenyl]-2-carboxylic acid, 4'-(bromomethyl)-, methyl ester |
| α-Bromo-2-(p-tolyl)benzoic acid methyl ester |
| 4Bromomethyl-Biphenyl-2-CarboxylicAcidMetyl |
| 4'-bromomethyl-2-methoxycarbonylbiphenyl |
| E1R DR BVO1 |
| methyl-4'-bromomethyl-biphenyl-2-caboxylate |
| 4-BROMOMETHYLBIPHENYL-2-CARBONYLATE |
| 4`-Bromomethylbiphenyl-2-carboxylic Acid,Methyl Ester |
| 4'-Bromomethylbiphenyl-2-carboxylate |
| Methyl 2-[4-(BroMoMethyl)phenyl]benzoate |
| Methyl-4'-bromomethyl biphenyl-2-carboxylato |
| 4-BROMOMETHGLBIPHENYL-2-CARBONYLETE |
| MFCD06200816 |
| 4'-Bromomethylbiphenyl-2-carboxylicacid methyl ester |