Introduction：Basic information about CAS 355806-00-7|tert-Butyl rosuvastatin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl rosuvastatin |
|---|
| CAS Number | 355806-00-7 | Molecular Weight | 537.644 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 704.2±70.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H36FN3O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 379.7±35.7 °C |
|---|
Names
| Name | tert-Butyl rosuvastatin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 704.2±70.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H36FN3O6S |
|---|
| Molecular Weight | 537.644 |
|---|
| Flash Point | 379.7±35.7 °C |
|---|
| Exact Mass | 537.230896 |
|---|
| PSA | 138.30000 |
|---|
| LogP | 2.24 |
|---|
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | IJHZGLLGELSZAF-OKLSWEBGSA-N |
|---|
| SMILES | CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1C=CC(O)CC(O)CC(=O)OC(C)(C)C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| Rosuvastatin calciuM interMediate R-3 |
| Rosuvastatin intermediate R-3 |
| Rosuvastatin intermediate R-2 |
| Rosuvastatin calciuM interMediate R-2 |
| 6-Heptenoic acid, 7-[4-(4-fluorophenyl)-6-(1-methylethyl)-2-[methyl(methylsulfonyl)amino]-5-pyrimidinyl]-3,5-dihydroxy-, 1,1-dimethylethyl ester, (3R,5S,6E)- |
| 1,3-Dioxane-4-acetic acid, 6-[(E)-2-[4-(4-fluorophenyl)-6-(1-methylethyl)-2-[methyl(methylsulfonyl)amino]-5-pyrimidinyl]ethenyl]-2,2-dimethyl-, 1,1-dimethylethyl ester |
| Rosuvastatin Acetonide t-Butyl Ester |
| Rosuvastatin tert-Butyl Ester |
| tert-Butyl {6-[(E)-2-{4-(4-fluorophenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]pyrimidin-5-yl}vinyl]-2,2-dimethyl-1,3-dioxan-4-yl}acetate |
| 2-Methyl-2-propanyl {6-[(E)-2-{4-(4-fluorophenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]-5-pyrimidinyl}vinyl]-2,2-dimethyl-1,3-dioxan-4-yl}acetate |
| tert-Butyl rosuvastatin |
| tert-butyl (3R,5S,6E)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-(propan-2-yl)pyrimidin-5-yl]-3,5-dihydroxyhept-6-enoate |
| R-1 interMediate |
| tert-Butyl rosuvasta |
| ZD-8 |
| 2-Methyl-2-propanyl (3R,5S,6E)-7-{4-(4-fluorophenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]-5-pyrimidinyl}-3,5-dihydroxy-6-heptenoate |
| tert-Butyl (3R,5S,6E)-7-{4-(4-fluorophenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]pyrimidin-5-yl}-3,5-dihydroxyhept-6-enoate |
| Rosuvastatin t-Butyl Ester |
