Introduction：Basic information about CAS 6821-06-3|2-(2-diethylaminoethyl)-1H-isoindole-1,3(2H)-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2-diethylaminoethyl)-1H-isoindole-1,3(2H)-dione |
|---|
| CAS Number | 6821-06-3 | Molecular Weight | 246.305 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 355.0±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 145.9±15.5 °C |
|---|
Names
| Name | 2-(2-diethylaminoethyl)-1H-isoindole-1,3(2H)-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 355.0±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18N2O2 |
|---|
| Molecular Weight | 246.305 |
|---|
| Flash Point | 145.9±15.5 °C |
|---|
| Exact Mass | 246.136826 |
|---|
| PSA | 40.62000 |
|---|
| LogP | 2.77 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.562 |
|---|
| InChIKey | IYFCGUZGMFMHPG-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)CCN1C(=O)c2ccccc2C1=O |
|---|
Synonyms
| N-(2-diethylaminoethyl)-phthalimide |
| 1H-Isoindole-1,3(2H)-dione, 2-[2-(diethylamino)ethyl]- |
| N-(2-diethylamino-ethyl)-phthalimide |
| N-[2-(N,N-Diethylamino)-ethyl]-phthalimid |
| N-(β-Diethylaminoethyl)-phthalimid |
| N-(2-Diaethylamino-aethyl)-phthalimid |
| 2-[2-(Diethylamino)ethyl]-1H-isoindole-1,3(2H)-dione |
| 2-(2-(diethylamino)ethyl)isoindoline-1,3-dione |
| N-(2-Diethylamino-ethyl)-phthalimid |
