Introduction：Basic information about CAS 111119-37-0|2,6-Dichlorophenylalanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Dichlorophenylalanine |
|---|
| CAS Number | 111119-37-0 | Molecular Weight | 234.079 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 368.1±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H9Cl2NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 176.4±27.9 °C |
|---|
Names
| Name | (S)-2-Amino-3-(2,6-dichlorophenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 368.1±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H9Cl2NO2 |
|---|
| Molecular Weight | 234.079 |
|---|
| Flash Point | 176.4±27.9 °C |
|---|
| Exact Mass | 233.001038 |
|---|
| PSA | 63.32000 |
|---|
| LogP | 2.32 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | LWFYNRYRKMEIIJ-QMMMGPOBSA-N |
|---|
| SMILES | NC(Cc1c(Cl)cccc1Cl)C(=O)O |
|---|
Synonyms
| 2,6-Dichlorophenylalanine |
| (2S)-2-amino-3-(2,6-dichlorophenyl)propanoic acid |
| Phenylalanine, 2,6-dichloro- |
