Introduction:Basic information about CAS 4282-47-7|5-Nitro-2-phenylpyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Nitro-2-phenylpyridine |
|---|
| CAS Number | 4282-47-7 | Molecular Weight | 200.193 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 354.3±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H8N2O2 | Melting Point | 116-118ºC |
|---|
| MSDS | / | Flash Point | 168.1±20.9 °C |
|---|
Names
| Name | 2-(4-Nitrophenyl)pyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 354.3±17.0 °C at 760 mmHg |
|---|
| Melting Point | 116-118ºC |
|---|
| Molecular Formula | C11H8N2O2 |
|---|
| Molecular Weight | 200.193 |
|---|
| Flash Point | 168.1±20.9 °C |
|---|
| Exact Mass | 200.058578 |
|---|
| PSA | 58.71000 |
|---|
| LogP | 2.25 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.611 |
|---|
| InChIKey | FNLTWLXKZQWUJZ-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(-c2ccccn2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-(2-pyridinyl)nitrobenzene |
| 2-(p-Nitrophenyl)pyridine |
| 5-Nitro-2-phenylpyridine |
| 2-(4'-nitrophenyl)pyridine |
| 4-nitrophenylpyridine |
| 2-(4'-Nitrophenyl)piridine |
| 4-(2-pyridyl)nitrobenzene |
| MFCD04114193 |
| Pyridine, 5-nitro-2-phenyl- |
| Pyridine, 2-(4-nitrophenyl)- |
| 2-(4-Nitrophenyl)pyridine |