Introduction：Basic information about CAS 355-24-8|1,4-dichloro-1,1,2,2,3,3,4,4-octafluorobutane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-dichloro-1,1,2,2,3,3,4,4-octafluorobutane |
|---|
| CAS Number | 355-24-8 | Molecular Weight | 270.93600 |
|---|
| Density | 1.681g/cm3 | Boiling Point | 64-65,6ºC |
|---|
| Molecular Formula | C4Cl2F8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 2.4ºC |
|---|
Names
| Name | 1,4-dichloro-1,1,2,2,3,3,4,4-octafluorobutane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.681g/cm3 |
|---|
| Boiling Point | 64-65,6ºC |
|---|
| Molecular Formula | C4Cl2F8 |
|---|
| Molecular Weight | 270.93600 |
|---|
| Flash Point | 2.4ºC |
|---|
| Exact Mass | 269.92500 |
|---|
| LogP | 3.92020 |
|---|
| Index of Refraction | 1.314 |
|---|
| InChIKey | LGBGVSJBKFDYKH-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(Cl)C(F)(F)C(F)(F)C(F)(F)Cl |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2903799090 |
|---|
Customs
| HS Code | 2903799090 |
|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1,4-dichloro-1,1,2,2,3,3,4,4-octafluoro-butane |
| 1,4-Dichloro-octafluorbutan |
| EINECS 206-579-8 |
| 1,4-dichloro-octafluoro-butane |
| 1,4-Dichlor-octafluor-butan |
