Introduction：Basic information about CAS 127163-51-3|2,2-Difluoro-1,3-benzodioxole-5-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2-Difluoro-1,3-benzodioxole-5-carbonyl chloride |
|---|
| CAS Number | 127163-51-3 | Molecular Weight | 220.55700 |
|---|
| Density | 1.66g/cm3 | Boiling Point | 44.5ºC at 760mmHg |
|---|
| Molecular Formula | C8H3ClF2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 2ºC |
|---|
Names
| Name | 2,2-Difluoro-1,3-benzodioxole-5-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.66g/cm3 |
|---|
| Boiling Point | 44.5ºC at 760mmHg |
|---|
| Molecular Formula | C8H3ClF2O3 |
|---|
| Molecular Weight | 220.55700 |
|---|
| Flash Point | 2ºC |
|---|
| Exact Mass | 219.97400 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 2.38710 |
|---|
| Vapour Pressure | 0.0572mmHg at 25°C |
|---|
| Index of Refraction | 1.5095 |
|---|
| InChIKey | TWAYOQDEKAESKD-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1ccc2c(c1)OC(F)(F)O2 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | UN 3265 |
|---|
| HS Code | 2932999099 |
|---|
Customs
| HS Code | 2932999099 |
|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2,2-difluorobenzo[1,3]dioxole-5-carbonyl chloride |
| PC0220 |
| 2,2-difluorobenzo[d][1,3]dioxole-5-carbonyl chloride |
| MFCD01631475 |
| 1,3-Benzodioxole-5-carbonylchloride,2,2-difluoro |
| 2,2-diflouro-benzo[1,3]dioxole 5-carbonyl chloride |
