Introduction：Basic information about CAS 2172-33-0|Vat Orange 11, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Vat Orange 11 |
|---|
| CAS Number | 2172-33-0 | Molecular Weight | 646.60200 |
|---|
| Density | 1.651 | Boiling Point | / |
|---|
| Molecular Formula | C42H18N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Vat Orange 11 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.651 |
|---|
| Molecular Formula | C42H18N2O6 |
|---|
| Molecular Weight | 646.60200 |
|---|
| Exact Mass | 646.11600 |
|---|
| PSA | 134.00000 |
|---|
| LogP | 7.28180 |
|---|
| Index of Refraction | 1.911 |
|---|
| InChIKey | CVWSULASWLZVCH-UHFFFAOYSA-N |
|---|
| SMILES | O=c1c2ccccc2c(=O)c2c1ccc1c3ccc4c(=O)c5c(ccc6c7ccc8c(=O)c9ccccc9c(=O)c8c7[nH]c65)c(=O)c4c3[nH]c12 |
|---|
Synonyms
| Cibanone Yellow 3R |
| Novatic Yellow 3R |
| 1.1',5.1'-Trianthrimid-2.2',7.2-dicarbazol |
| C.I.VATORANGE11 |
| Yellow 3RT |
| Convat Orange AA |
| C.I.Vat Yellow 11 |
| 6H,18H-Dinaphtho[2,3-i,2',3'-i']benzo[1,2-a,4,5-a']dicarbazol-5,7,12,17,19,24-hexaon |
| Indanthrengelb 3R |
| 6H,18H-dinaphtho[2,3-i,2',3'-i']benzo[1,2-a,4,5-a']dicarbazole-5,7,12,17,19,24-hexaone |
| Vat Yellow 3RT |
| 6,18-dihydrodinaphtho[2,3-i:2',3'-i']benzo[1,2-a:4,5-a']dicarbazole-5,7,12,17,19,24-hexone |
