Introduction：Basic information about CAS 117-42-0|1,3,6-Naphthalenetrisulfonicacid, 8-amino-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,6-Naphthalenetrisulfonicacid, 8-amino- |
|---|
| CAS Number | 117-42-0 | Molecular Weight | 383.37500 |
|---|
| Density | 1.974g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H9NO9S3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Koch acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.974g/cm3 |
|---|
| Molecular Formula | C10H9NO9S3 |
|---|
| Molecular Weight | 383.37500 |
|---|
| Exact Mass | 382.94400 |
|---|
| PSA | 214.27000 |
|---|
| LogP | 3.98570 |
|---|
| InChIKey | UBDHSURDYAETAL-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c12 |
|---|
Safety Information
Customs
| HS Code | 2921499090 |
|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 1-Aminonaphthalene-3,6,8-trisulfonic acid |
| Naphthylamin-(1)-trisulfonsaeure-(3.6.8) |
| 8-aminonaphthalene-1,3,6-trisulphonic acid |
| 8-amino-naphthalene-1,3,6-trisulfonic acid |
| 8-Amino-naphthalin-1,3,6-trisulfonsaeure |
| EINECS 204-188-7 |
| 2-Naphthyl |
| 1-aminonaphthalene-3,6,8-trisulphonic acid |
| 1,3,6-Naphthalenetrisulfonic acid,8-amino |
| 8-amino-1,3,6-naphthalenetrisulfonic acid |
| 3,6,8-Trisulfo-1-naphthylamine |
| 3,6-Naphthalenetrisulfonic acid,8-amino-1 |
| 1-AMinonapthelene 3,6,8 trisulfonic acid disodiuM |
| 6-naphthalenetrisulfonic acid,8-amino-3 |
