Introduction:Basic information about CAS 519056-68-9|4-(2-FURYLMETHYL)-5-(1-NAPHTHYL)-4H-1,2,4-TRIAZOLE-3-THIOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2-FURYLMETHYL)-5-(1-NAPHTHYL)-4H-1,2,4-TRIAZOLE-3-THIOL |
|---|
| CAS Number | 519056-68-9 | Molecular Weight | 307.37000 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 465.1ºC at 760 mmHg |
|---|
| Molecular Formula | C17H13N3OS | Melting Point | 177ºC |
|---|
| MSDS | / | Flash Point | 235.1ºC |
|---|
Names
| Name | 4-(furan-2-ylmethyl)-3-naphthalen-1-yl-1H-1,2,4-triazole-5-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 465.1ºC at 760 mmHg |
|---|
| Melting Point | 177ºC |
|---|
| Molecular Formula | C17H13N3OS |
|---|
| Molecular Weight | 307.37000 |
|---|
| Flash Point | 235.1ºC |
|---|
| Exact Mass | 307.07800 |
|---|
| PSA | 82.65000 |
|---|
| LogP | 4.02830 |
|---|
| Index of Refraction | 1.715 |
|---|
| InChIKey | DZJWQPXUCPWEBC-UHFFFAOYSA-N |
|---|
| SMILES | S=c1[nH]nc(-c2cccc3ccccc23)n1Cc1ccco1 |
|---|
Synonyms
| 4-(2-furylmethyl)-5-(1-naphthyl)-4H-1,2,4-triazole-3-thiol |
| Y9315 |