Introduction：Basic information about CAS 519056-57-6|3-[[2-(trifluoromethyl)phenyl]carbamothioylamino]propanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[[2-(trifluoromethyl)phenyl]carbamothioylamino]propanoic acid |
|---|
| CAS Number | 519056-57-6 | Molecular Weight | 292.27700 |
|---|
| Density | 1.458g/cm3 | Boiling Point | 393.8ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11F3N2O2S | Melting Point | 124ºC |
|---|
| MSDS | / | Flash Point | 192ºC |
|---|
Names
| Name | 3-[[2-(trifluoromethyl)phenyl]carbamothioylamino]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.458g/cm3 |
|---|
| Boiling Point | 393.8ºC at 760 mmHg |
|---|
| Melting Point | 124ºC |
|---|
| Molecular Formula | C11H11F3N2O2S |
|---|
| Molecular Weight | 292.27700 |
|---|
| Flash Point | 192ºC |
|---|
| Exact Mass | 292.04900 |
|---|
| PSA | 93.45000 |
|---|
| LogP | 2.93040 |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | XYMHGKUYYQCCBV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCNC(=S)Nc1ccccc1C(F)(F)F |
|---|
Synonyms
| HMS561I14 |
| 3-({[2-(trifluoromethyl)anilino]carbothioyl}amino)propanoic acid |
