Introduction：Basic information about CAS 73257-47-3|dimethyl 4-(4-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dimethyl 4-(4-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|
| CAS Number | 73257-47-3 | Molecular Weight | 331.36300 |
|---|
| Density | 1.164g/cm3 | Boiling Point | 458.3ºC at 760 mmHg |
|---|
| Molecular Formula | C18H21NO5 | Melting Point | 173ºC |
|---|
| MSDS | / | Flash Point | 231ºC |
|---|
Names
| Name | dimethyl 4-(4-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.164g/cm3 |
|---|
| Boiling Point | 458.3ºC at 760 mmHg |
|---|
| Melting Point | 173ºC |
|---|
| Molecular Formula | C18H21NO5 |
|---|
| Molecular Weight | 331.36300 |
|---|
| Flash Point | 231ºC |
|---|
| Exact Mass | 331.14200 |
|---|
| PSA | 73.86000 |
|---|
| LogP | 2.60480 |
|---|
| Index of Refraction | 1.531 |
|---|
| InChIKey | IAXDEFZXLVTHLU-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1ccc(OC)cc1 |
|---|
Safety Information
Synonyms
| 1,4-dihydro-2,6-dimethyl-4-(p-methoxyphenyl)pyridine-3,5-dicarboxylic acid dimethyl ester |
| dimethyl 1,4-dihydro-4-(4-methoxyphenyl)-2,6-dimethyl-3,5-pyridinedicarboxylate |
| Dimethyl 4-(4-methoxyphenyl)-2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarboxylate |
| dimethyl 1,4-dihydro-4-(4-methoxyphenyl)-2,6-dimethylpyridine-3,5-dicarboxylate |
| 2,6-dimethyl-3,5-di(methoxycarbonyl)-4-(p-methoxyphenyl)-1,4-dihydropyridine |
| 1,4-dihydro-2,6-dimethyl-4-(4-methoxyphenyl)-3,5-pyridinedicarboxylic acid dimethyl ester |
| 4-(4-methoxyphenyl)-2,6-dimethyl-3,5-dimethoxycarbonyl-1,4-dihydropyridine |
