Introduction：Basic information about CAS 852180-41-7|4-(3-isocyanatophenyl)-2-methyl-1,3-thiazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(3-isocyanatophenyl)-2-methyl-1,3-thiazole |
|---|
| CAS Number | 852180-41-7 | Molecular Weight | 216.25900 |
|---|
| Density | 1.25g/cm3 | Boiling Point | 365.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8N2OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 174.7ºC |
|---|
Names
| Name | 4-(3-isocyanatophenyl)-2-methyl-1,3-thiazole |
|---|
Chemical & Physical Properties
| Density | 1.25g/cm3 |
|---|
| Boiling Point | 365.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8N2OS |
|---|
| Molecular Weight | 216.25900 |
|---|
| Flash Point | 174.7ºC |
|---|
| Exact Mass | 216.03600 |
|---|
| PSA | 70.56000 |
|---|
| LogP | 3.08580 |
|---|
| Index of Refraction | 1.645 |
|---|
| InChIKey | FGXXZVGMPBZEBB-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(-c2cccc(N=C=O)c2)cs1 |
|---|
