Introduction：Basic information about CAS 5429-07-2|2-(7-chloroquinolin-4-yl)sulfanylacetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(7-chloroquinolin-4-yl)sulfanylacetic acid |
|---|
| CAS Number | 5429-07-2 | Molecular Weight | 253.70500 |
|---|
| Density | 1.49g/cm3 | Boiling Point | 465.1ºC at 760mmHg |
|---|
| Molecular Formula | C11H8ClNO2S | Melting Point | 223ºC |
|---|
| MSDS | USA | Flash Point | 235.1ºC |
|---|
Names
| Name | 2-(7-chloroquinolin-4-yl)sulfanylacetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.49g/cm3 |
|---|
| Boiling Point | 465.1ºC at 760mmHg |
|---|
| Melting Point | 223ºC |
|---|
| Molecular Formula | C11H8ClNO2S |
|---|
| Molecular Weight | 253.70500 |
|---|
| Flash Point | 235.1ºC |
|---|
| Exact Mass | 252.99600 |
|---|
| PSA | 75.49000 |
|---|
| LogP | 3.06490 |
|---|
| Index of Refraction | 1.704 |
|---|
| InChIKey | YFWVKWISZZSPFR-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CSc1ccnc2cc(Cl)ccc12 |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-[(7-chloro-4-quinolinyl)sulfanyl]acetic acid |
| (7-Chlor-[4]chinolylmercapto)-essigsaeure |
| 4-carboxymethylthio-7-chloroquinoline |
| (7-chloro-[4]quinolylmercapto)-acetic acid |
