Introduction：Basic information about CAS 1101-67-3|dansyl-l-glutamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dansyl-l-glutamine |
|---|
| CAS Number | 1101-67-3 | Molecular Weight | 379.43100 |
|---|
| Density | 1.384g/cm3 | Boiling Point | 679.5ºC at 760mmHg |
|---|
| Molecular Formula | C17H21N3O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | dansyl-l-glutamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.384g/cm3 |
|---|
| Boiling Point | 679.5ºC at 760mmHg |
|---|
| Molecular Formula | C17H21N3O5S |
|---|
| Molecular Weight | 379.43100 |
|---|
| Exact Mass | 379.12000 |
|---|
| PSA | 138.18000 |
|---|
| LogP | 3.07480 |
|---|
| Vapour Pressure | 2.15E-19mmHg at 25°C |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | AMOCBWNWZULALT-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NC(CCC(N)=O)C(=O)O)cccc12 |
|---|
| Storage condition | −20°C |
|---|
Safety Information
| WGK Germany | 3 |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| dansyl-L-glutamic acid |
| N2-[[5-(Dimethylamino)-1-naphthalenyl]sulfonyl]-L-glutamine |
| N2-[[5-(dimethylamino)-1-naphthyl]sulphonyl]-L-glutamine |
| EINECS 214-156-4 |
| 5-amino-2-[[5-(dimethylamino)-1-naphthyl]sulfonylamino]-5-keto-valeric acid |
| dansyl-L-glutamine free acid |
| MFCD00037732 |
| dansyl L-glutamine |
| Dansyl-L-dlutamine |
| Dns-L-Gln-OH |
| (2S)-2-(5-Dimethylamino-1-naphtylsulfonylamino)-4-carbamoylbutanoic acid |
| 5-amino-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-5-oxopentanoic acid |
| N2-[5-(Dimethylamino)-1-naphtylsulfonyl]-L-glutamine |
