Introduction:Basic information about CAS 90561-85-6|2-bromo-4-nitro-1,3,5-trimethylbenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-bromo-4-nitro-1,3,5-trimethylbenzene |
|---|
| CAS Number | 90561-85-6 | Molecular Weight | 244.08500 |
|---|
| Density | 1.467g/cm3 | Boiling Point | 106-107 °C1.3 mm Hg(lit.) |
|---|
| Molecular Formula | C9H10BrNO2 | Melting Point | 59-64 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 106-107°C/1.3mm |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-bromo-1,3,5-trimethyl-4-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.467g/cm3 |
|---|
| Boiling Point | 106-107 °C1.3 mm Hg(lit.) |
|---|
| Melting Point | 59-64 °C(lit.) |
|---|
| Molecular Formula | C9H10BrNO2 |
|---|
| Molecular Weight | 244.08500 |
|---|
| Flash Point | 106-107°C/1.3mm |
|---|
| Exact Mass | 242.98900 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.80570 |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | IUFDRRDWXUSFBG-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c([N+](=O)[O-])c(C)c1Br |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4-Bromo-2-nitromesitylene |
| Brom-nitro-mesitylen |
| 1-Bromo-3-nitro-2,4,6-trimethylbenzene |
| 2-bromo-4-nitro-1,3,5-trimethylbenzene |
| MFCD00015924 |
| 3-Bromo-2,4,6-trimethylnitrobenzene |
| 2-Brom-4-nitro-mesitylen |
| 2-bromo-1,3,5-trimethyl-4-nitro-benzene |
| 2-Brom-1,3,5-trimethyl-4-nitro-benzol |