Introduction:Basic information about CAS 955314-83-7|2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)ethanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)ethanol |
|---|
| CAS Number | 955314-83-7 | Molecular Weight | 265.34800 |
|---|
| Density | 1.068g/cm3 | Boiling Point | 422.9ºC at 760 mmHg |
|---|
| Molecular Formula | C15H23NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 209.5ºC |
|---|
Names
| Name | 2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)ethanol |
|---|
Chemical & Physical Properties
| Density | 1.068g/cm3 |
|---|
| Boiling Point | 422.9ºC at 760 mmHg |
|---|
| Molecular Formula | C15H23NO3 |
|---|
| Molecular Weight | 265.34800 |
|---|
| Flash Point | 209.5ºC |
|---|
| Exact Mass | 265.16800 |
|---|
| PSA | 50.72000 |
|---|
| LogP | 2.38200 |
|---|
| Index of Refraction | 1.517 |
|---|
| InChIKey | YULIMDKKVQKHCR-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1cc2c(cc1OCC)C(CCO)NCC2 |
|---|