Introduction:Basic information about CAS 5418-51-9|5-nitropyridin-2-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-nitropyridin-2-ol |
|---|
| CAS Number | 5418-51-9 | Molecular Weight | 140.097 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 419.4±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C5H4N2O3 | Melting Point | 188-191 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 207.4±24.6 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-Hydroxy-5-nitropyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 419.4±30.0 °C at 760 mmHg |
|---|
| Melting Point | 188-191 °C(lit.) |
|---|
| Molecular Formula | C5H4N2O3 |
|---|
| Molecular Weight | 140.097 |
|---|
| Flash Point | 207.4±24.6 °C |
|---|
| Exact Mass | 140.022186 |
|---|
| PSA | 78.94000 |
|---|
| LogP | -0.45 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | XKWSQIMYNVLGBO-UHFFFAOYSA-N |
|---|
| SMILES | O=c1ccc([N+](=O)[O-])c[nH]1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-nitro-1H-pyridin-2-one |
| MFCD00006276 |
| 5-Nitropyridin-2(1H)-one |
| 2(1H)-Pyridinone, 5-nitro- |
| 5-nitropyridin-2-ol |
| EINECS 226-525-7 |
| 2-Hydroxy-5-nitropyridine |
| 5-Nitro-2(1H)-pyridinon |
| 5-Nitro-2(1H)-pyridinone |
| 5-Nitropyridin-2(1H)-on |