Introduction：Basic information about CAS 125225-28-7|ipconazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ipconazole |
|---|
| CAS Number | 125225-28-7 | Molecular Weight | 333.85600 |
|---|
| Density | 1.24g/cm3 | Boiling Point | 486ºC at 760mmHg |
|---|
| Molecular Formula | C18H24ClN3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 247.7ºC |
|---|
Names
| Name | ipconazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.24g/cm3 |
|---|
| Boiling Point | 486ºC at 760mmHg |
|---|
| Molecular Formula | C18H24ClN3O |
|---|
| Molecular Weight | 333.85600 |
|---|
| Flash Point | 247.7ºC |
|---|
| Exact Mass | 333.16100 |
|---|
| PSA | 50.94000 |
|---|
| LogP | 3.58750 |
|---|
| Vapour Pressure | 2.94E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | QTYCMDBMOLSEAM-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)C1CCC(Cc2ccc(Cl)cc2)C1(O)Cn1cncn1 |
|---|
Synonyms
| 1RS,2SR,5SR)-2-(4-chlorobenzyl)-5-isopropyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol |
| 2-[(4-chlorophenyl)methyl]-5-(1-methylethyl)-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol |
| Ipconazole |
| 2-[(4-chlorophenyl)methyl]-5-propan-2-yl-1-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-ol |
| (1RS,2SR,5RS |
| (1Ξ,2Ξ,5Ξ)-2-[(4-chlorophenyl)methyl]-5-(propan-2-yl)-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentan-1-ol |
