Introduction:Basic information about CAS 21959-01-3|Tetrachlorobis(tetrahydrofuran)zirconium, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tetrachlorobis(tetrahydrofuran)zirconium |
|---|
| CAS Number | 21959-01-3 | Molecular Weight | 377.24700 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H16Cl4O2Zr | Melting Point | 175-177 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS02, GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | oxolane,tetrachlorozirconium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 175-177 °C(lit.) |
|---|
| Molecular Formula | C8H16Cl4O2Zr |
|---|
| Molecular Weight | 377.24700 |
|---|
| Exact Mass | 373.89500 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 4.35160 |
|---|
| Appearance of Characters | crystal,white |
|---|
| Vapour Pressure | 152mmHg at 25°C |
|---|
| InChIKey | VDJJKYYENYIHFF-UHFFFAOYSA-J |
|---|
| SMILES | C1CCOC1.C1CCOC1.Cl[Zr](Cl)(Cl)Cl |
|---|
| Storage condition | 0-6°C |
|---|
Safety Information
| Symbol | GHS02, GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H228-H302 + H312 + H332-H314 |
|---|
| Precautionary Statements | P210-P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R20/21/22;R34 |
|---|
| Safety Phrases | S22-S26-S36/37/39-S45 |
|---|
| RIDADR | UN 2925 4.1/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
Synonyms
| ZrCl4(tetrahydrofuran)2 |
| [ZrCl4(thf)2] |
| Zirconium(IV) chloride tetrahydrofuran complex (1:2) |
| tetrachlorobis(tetrahydrofuran-O)zirconium(IV) |
| MFCD00145367 |
| Tetrachlorobis(tetrahydrofuran)zirconium |
| Tetrachlorobis(tetrahydrofuran)zirconium(IV) |
| Zirconium tetrachloride tetrahydrofuran complex |