Introduction:Basic information about CAS 86156-94-7|3-Fluoro-4-nitrobenzenesulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Fluoro-4-nitrobenzenesulfonic acid |
|---|
| CAS Number | 86156-94-7 | Molecular Weight | 221.16300 |
|---|
| Density | 1.724 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C6H4FNO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-Fluoro-4-nitrobenzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.724 g/cm3 |
|---|
| Molecular Formula | C6H4FNO5S |
|---|
| Molecular Weight | 221.16300 |
|---|
| Exact Mass | 220.97900 |
|---|
| PSA | 108.57000 |
|---|
| LogP | 2.58460 |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | QHCAHAXGOGJVLY-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)O)cc1F |
|---|
Synonyms
| Benzenesulfonic acid,3-fluoro-4-nitro |
| I01-7875 |