Introduction:Basic information about CAS 53977-47-2|1-isopropyl-4-oxo-1,4-dihydro-3-quinolinecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-isopropyl-4-oxo-1,4-dihydro-3-quinolinecarboxylic acid |
|---|
| CAS Number | 53977-47-2 | Molecular Weight | 231.24700 |
|---|
| Density | 1.288g/cm3 | Boiling Point | 362.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13NO3 | Melting Point | 200-203ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 173.1ºC |
|---|
Names
| Name | 1-isopropyl-4-oxo-1,4-dihydro-3-quinolinecarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.288g/cm3 |
|---|
| Boiling Point | 362.6ºC at 760 mmHg |
|---|
| Melting Point | 200-203ºC |
|---|
| Molecular Formula | C13H13NO3 |
|---|
| Molecular Weight | 231.24700 |
|---|
| Flash Point | 173.1ºC |
|---|
| Exact Mass | 231.09000 |
|---|
| PSA | 59.30000 |
|---|
| LogP | 2.28060 |
|---|
| InChIKey | GMQZCXRSOWOGAH-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)n1cc(C(=O)O)c(=O)c2ccccc21 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 1-isopropyl-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid |