Introduction：Basic information about CAS 127106-71-2|Boc-(S)-3-Amino-4-(4-nitrophenyl)-butyric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-(S)-3-Amino-4-(4-nitrophenyl)-butyric acid |
|---|
| CAS Number | 127106-71-2 | Molecular Weight | 324.329 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 509.3±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H20N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 261.8±30.1 °C |
|---|
Names
| Name | Boc-(S)-3-amino-4-(4-nitrophenyl)-butyric acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 509.3±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H20N2O6 |
|---|
| Molecular Weight | 324.329 |
|---|
| Flash Point | 261.8±30.1 °C |
|---|
| Exact Mass | 324.132141 |
|---|
| PSA | 121.45000 |
|---|
| LogP | 2.77 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.559 |
|---|
| InChIKey | HTDDLFNQWIQXQX-NSHDSACASA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)Cc1ccc([N+](=O)[O-])cc1 |
|---|
Synonyms
| (3S)-3-Amino-5-[(2-methyl-2-propanyl)oxy]-4-(4-nitrophenyl)-5-oxopentanoic acid |
| Pentanedioic acid, 3-amino-2-(4-nitrophenyl)-, 1-(1,1-dimethylethyl) ester, (3S)- |
| Benzenebutanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-4-nitro-, (βS)- |
| boc-(s)-3-amino-4-(4-nitro-phenyl)-butyric acid |
| (3S)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(4-nitrophenyl)butanoic acid |
| MFCD01076286 |
| (3S)-3-[(tert-Butoxycarbonyl)amino]-4-(4-nitrophenyl)butanoic acid |
