Introduction:Basic information about CAS 19647-71-3|z-phe-pna, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | z-phe-pna |
|---|
| CAS Number | 19647-71-3 | Molecular Weight | 419.43000 |
|---|
| Density | 1.319±0.06 g/cm3 | Boiling Point | 696.9±55.0 °C |
|---|
| Molecular Formula | C23H21N3O5 | Melting Point | 159 °C |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
Names
| Name | benzyl N-[(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.319±0.06 g/cm3 |
|---|
| Boiling Point | 696.9±55.0 °C |
|---|
| Melting Point | 159 °C |
|---|
| Molecular Formula | C23H21N3O5 |
|---|
| Molecular Weight | 419.43000 |
|---|
| Exact Mass | 419.14800 |
|---|
| PSA | 113.25000 |
|---|
| LogP | 5.05810 |
|---|
| InChIKey | JZPHGMKKKDRFSU-NRFANRHFSA-N |
|---|
| SMILES | O=C(NC(Cc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1)OCc1ccccc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xn |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Z-L-Phe p-nitroanilide |
| Z-Phe-p-nitroanilid |
| Cbz-Phe-p-nitroanilide |
| N-benzoyloxycarbonyl-L-phenylalanine-p-nitroanilide |
| Z-L-Phe-pNA |
| MFCD00038114 |
| N-(benzyloxycarbonyl)-L-phenylalanine p-nitroanilide |