Introduction:Basic information about CAS 4284-09-7|3-chloro-2,4,5,6-tetrafluorobenzotrifluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-chloro-2,4,5,6-tetrafluorobenzotrifluoride |
|---|
| CAS Number | 4284-09-7 | Molecular Weight | 252.51700 |
|---|
| Density | 1,7 g/cm3 | Boiling Point | 137 °C |
|---|
| Molecular Formula | C7ClF7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 43.9ºC |
|---|
Names
| Name | 1-chloro-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1,7 g/cm3 |
|---|
| Boiling Point | 137 °C |
|---|
| Molecular Formula | C7ClF7 |
|---|
| Molecular Weight | 252.51700 |
|---|
| Flash Point | 43.9ºC |
|---|
| Exact Mass | 251.95800 |
|---|
| LogP | 3.91520 |
|---|
| Index of Refraction | 1.391 |
|---|
| InChIKey | WFPMVEWSBGBVKV-UHFFFAOYSA-N |
|---|
| SMILES | Fc1c(F)c(Cl)c(F)c(C(F)(F)F)c1F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2903999090 |
|---|
Customs
| HS Code | 2903999090 |
|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 3-Chloro-α,α,α,2,4,5,6-heptafluorotoluene |
| 3-Chloro-2,4,5,6-tetrafluorobenzotrifluoride |
| 3-chloro-tetra-fluorobenzotrifluoride |
| 3-chloroheptafluorotoluene |
| 1-trifluoromethyl-2,4,5,6-tetrafluoro-3-chlorobenzene |
| MFCD03094143 |
| 1-chloro-2,4,5,6-tetrafluoro-3-trifluoromethylbenzene |
| C126 |
| PC1981 |
| AC1MCSQZ |
| 2,3,4,6-tetrafluoro-5-chlorobenzotrifluoride |