Introduction:Basic information about CAS 219968-28-2|nomega-(2-acetamido-3,4,6-tri-o-benzyl-2-deoxy-beta-d-glucopyranosyl)-nalpha-(tert-b, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | nomega-(2-acetamido-3,4,6-tri-o-benzyl-2-deoxy-beta-d-glucopyranosyl)-nalpha-(tert-butoxycarbonyl)-l-asparagine benzyl ester |
|---|
| CAS Number | 219968-28-2 | Molecular Weight | 795.91600 |
|---|
| Density | 1.249g/cm3 | Boiling Point | 951.381ºC at 760 mmHg |
|---|
| Molecular Formula | C45H53N3O10 | Melting Point | 214 °C(dec.) |
|---|
| MSDS | / | Flash Point | 529.176ºC |
|---|
Names
| Name | benzyl (2S)-4-[[(2R,3R,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
|---|
Chemical & Physical Properties
| Density | 1.249g/cm3 |
|---|
| Boiling Point | 951.381ºC at 760 mmHg |
|---|
| Melting Point | 214 °C(dec.) |
|---|
| Molecular Formula | C45H53N3O10 |
|---|
| Molecular Weight | 795.91600 |
|---|
| Flash Point | 529.176ºC |
|---|
| Exact Mass | 795.37300 |
|---|
| PSA | 159.75000 |
|---|
| LogP | 6.91930 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.6 |
|---|
| InChIKey | CRNGSGNVFXQOBD-VEEXYVTKSA-N |
|---|
| SMILES | CC(=O)NC1C(NC(=O)CC(NC(=O)OC(C)(C)C)C(=O)OCc2ccccc2)OC(COCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
|---|
| Storage condition | Freezer |
|---|