Introduction:Basic information about CAS 4042-30-2|parvaquone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | parvaquone |
|---|
| CAS Number | 4042-30-2 | Molecular Weight | 256.29600 |
|---|
| Density | 1.31 g/cm3 | Boiling Point | 421.339ºC at 760mmHg |
|---|
| Molecular Formula | C16H16O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 222.766ºC |
|---|
Names
| Name | 3-cyclohexyl-4-hydroxynaphthalene-1,2-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.31 g/cm3 |
|---|
| Boiling Point | 421.339ºC at 760mmHg |
|---|
| Molecular Formula | C16H16O3 |
|---|
| Molecular Weight | 256.29600 |
|---|
| Flash Point | 222.766ºC |
|---|
| Exact Mass | 256.11000 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 3.45800 |
|---|
| Vapour Pressure | 3.73E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | XBGHCDVBZZNDBY-UHFFFAOYSA-N |
|---|
| SMILES | O=C1C(=O)c2ccccc2C(O)=C1C1CCCCC1 |
|---|
Safety Information
Customs
| HS Code | 2914690090 |
|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 2-hydroxy-3-cyclohexyl-1,4-naphthoquinone |
| 1,4-Naphthalenedione,2-cyclohexyl-3-hydroxy |
| Parvaquona [Spanish] |
| Parvaquonum [Latin] |
| 2-Cyclohexyl-3-hydroxy-[1,4]naphthochinon |
| EINECS 223-734-5 |
| 2-cyclohexyl-3-hydroxynaphthalene-1,4-dione |
| Parvaquone |
| 2-cyclohexyl-3-hydroxynaphtho-1,4-quinone |
| 2-Cyclohexyl-3-hydroxy-1,4-naphthoquinone |