Introduction：Basic information about CAS 7579-36-4|Dibenzyl oxalate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dibenzyl oxalate |
|---|
| CAS Number | 7579-36-4 | Molecular Weight | 270.280 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 388.7±31.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H14O4 | Melting Point | 80-82ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 171.4±24.9 °C |
|---|
Names
| Name | Dibenzyl oxalate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 388.7±31.0 °C at 760 mmHg |
|---|
| Melting Point | 80-82ºC |
|---|
| Molecular Formula | C16H14O4 |
|---|
| Molecular Weight | 270.280 |
|---|
| Flash Point | 171.4±24.9 °C |
|---|
| Exact Mass | 270.089203 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 3.22 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.570 |
|---|
| InChIKey | ZYZXGWGQYNTGAU-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OCc1ccccc1)C(=O)OCc1ccccc1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| MFCD00426620 |
| dibenzyl ethanedioate |
| Dibenzyl oxalate |
| bis(phenylmethyl) oxalate |
| Dibenzyl-oxalat |
| Ethanedioic acid, bis(phenylmethyl) ester |
| Oxalsaeure-dibenzylester |
| Dibenzyl Oxylate |
| Dibenzyl-oxalate |
| Oxalic acid dibenzyl ester |
| Oxalic acid,dibenzyl ester |
| Ethanedioic acid,bis(phenylmethyl) ester |
| dibenzyl dicarboxylate |
| Oxalic acid, dibenzyl ester |
| EINECS 411-720-3 |
