Introduction：Basic information about CAS 147118-40-9|Rosuvastatin methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Rosuvastatin methyl ester |
|---|
| CAS Number | 147118-40-9 | Molecular Weight | 495.564 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 692.3±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H30FN3O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 372.5±34.3 °C |
|---|
Names
| Name | methyl (E,3R,5S)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dihydroxyhept-6-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 692.3±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H30FN3O6S |
|---|
| Molecular Weight | 495.564 |
|---|
| Flash Point | 372.5±34.3 °C |
|---|
| Exact Mass | 495.183929 |
|---|
| PSA | 138.30000 |
|---|
| LogP | 1.01 |
|---|
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | SUTPUCLJAVPJRS-NDZBKKTDSA-N |
|---|
| SMILES | COC(=O)CC(O)CC(O)C=Cc1c(-c2ccc(F)cc2)nc(N(C)S(C)(=O)=O)nc1C(C)C |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 7-[4-(4-fluorophenyl)-6-isopropyl-2-(methylsulfonyl-methyl-amino)pyrimidin-5-yl]-3,5-dihydroxy-hept-6-enoic acid methyl ester |
| Methyl (3R,5S,6E)-7-{4-(4-fluorophenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]pyrimidin-5-yl}-3,5-dihydroxyhept-6-enoate |
| (+)-7-(4-(4-fluorophenyl)-6-isopropyl-2-(methanesulfonyl-methyl-amino)-pyrimidin-5-yl)-(3R,5S,6E)-dihydroxy-hept-6-enoic acid methyl ester |
| X6287 |
| methyl (3R,5S,6E)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-(propan-2-yl)pyrimidin-5-yl]-3,5-dihydroxyhept-6-enoate |
| Methyl (3R,5S,6E)-7-{4-(4-fluorophenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]-5-pyrimidinyl}-3,5-dihydroxy-6-heptenoate |
| methyl (6E)-7-{4-(4-flurophenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]pyrimidin-5-yl}(3R,5S)-3,5-dihydroxyhept-6-enoate |
| Rosuvastatin methyl ester |
| (E)-7-[4-(4-fluorophenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]-pyrimidin-5-yl](3R,5S)-3,5-dihydroxyhept-6-enoic acid methyl ester |
| methyl (3R,5S,6E)-7-[4-(4-flurophenyl)-6-(1-methylethyl)-2-[methyl(methylsulfonyl)amino]-5-pyrimidyl]-3,5-dihydroxy-6-heptenoate |
| (3R,5S,6E)-7-[4-(4-fluorophenyl)-6-(1-methylethyl)]-2-[methyl(methylsulfonyl)amino-5-pyrimidinyl]-3,5-dihydroxy-6-heptenoic acid methyl ester |
| AC-3412 |
| 6-Heptenoic acid, 7-[4-(4-fluorophenyl)-6-(1-methylethyl)-2-[methyl(methylsulfonyl)amino]-5-pyrimidinyl]-3,5-dihydroxy-, methyl ester, (3R,5S,6E)- |
| (3R,5S,6E)-7-[4-(4-Fluorophenyl)-6-isopropyl-2-(N-methyl-N-methylsulfonyl amino)pyrinidine-5-yl]-3,5-dihydrosy-6-heptane acid methyl ester |
