Introduction：Basic information about CAS 147511-70-4|(3R,5S)-7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolyl]- 3,5-dihydrosy-6-heptane aci, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3R,5S)-7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolyl]- 3,5-dihydrosy-6-heptane acid, |
|---|
| CAS Number | 147511-70-4 | Molecular Weight | 542.640 |
|---|
| Density | 0.691 g/cm3 | Boiling Point | 14.2ºC at 760 mmHg |
|---|
| Molecular Formula | C33H35FN2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (3R,5S)-7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolyl]- 3,5-dihydrosy-6-heptane acid, |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.691 g/cm3 |
|---|
| Boiling Point | 14.2ºC at 760 mmHg |
|---|
| Molecular Formula | C33H35FN2O4 |
|---|
| Molecular Weight | 542.640 |
|---|
| Exact Mass | 542.258057 |
|---|
| PSA | 116.67000 |
|---|
| LogP | 6.92470 |
|---|
| InChIKey | NWJUCTSWJKMGJX-FLBGKGFLSA-N |
|---|
| SMILES | CC(N)c1ccccc1.O=C(O)CC(O)CC(O)C=Cc1c(C2CC2)nc2ccccc2c1-c1ccc(F)cc1 |
|---|
Synonyms
| (R)-Butyl phenyl carbinol |
| pitavastatin (R)-1-phenylethylamine salt |
| 1-phenyl-1-pentanol |
| (R)-1-Phenylpentanol |
| (3R,5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl]-3,5-dihydroxy-6-heptenoic acid (R)-1-phenylethylamine salt |
| (+)-1-Phenylpentanol |
| pitavastatin phenylethanamine salt |
| (R)-1-phenyl-1-pentanol |
| (3R,5S,6E)-7-[2-Cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl]-3,5-dihydroxy-6-heptenoic acid - (1R)-1-phenylethanamine (1:1) |
| (R)-1-phenylpentan-1-ol |
| phenyl n-butyl carbinol |
| 6-Heptenoic acid, 7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl]-3,5-dihydroxy-, (3R,5S,6E)-, compd. with (αR)-α-methylbenzenemethanamine (1:1) |
| (+)-1-Phenylpentan-1-ol |
| (R)-1-phenylethanamine (3R,5S,E)-7-(2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl)-3,5-dihydroxyhept-6-enoate |
