Introduction：Basic information about CAS 86776-52-5|4-Cyano-3-fluorophenyl 4-butylbenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Cyano-3-fluorophenyl 4-butylbenzoate |
|---|
| CAS Number | 86776-52-5 | Molecular Weight | 297.32400 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C18H16FNO2 | Melting Point | 8 °C |
|---|
| MSDS | / | Flash Point | 219 °C |
|---|
Names
| Name | (4-cyano-3-fluorophenyl) 4-butylbenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 8 °C |
|---|
| Molecular Formula | C18H16FNO2 |
|---|
| Molecular Weight | 297.32400 |
|---|
| Flash Point | 219 °C |
|---|
| Exact Mass | 297.11700 |
|---|
| PSA | 50.09000 |
|---|
| LogP | 4.25918 |
|---|
| Index of Refraction | 1.56 |
|---|
| InChIKey | IBUUMDHMTARCSQ-UHFFFAOYSA-N |
|---|
| SMILES | CCCCc1ccc(C(=O)Oc2ccc(C#N)c(F)c2)cc1 |
|---|
Synonyms
| 4-Cyano-3-fluorophenyl 4-butylbenzoate |
| Benzoic acid,4-butyl-,4-cyano-3-fluorophenyl ester |
| 4-Butyl-benzoic acid 4-cyano-3-fluoro-phenyl ester |
