Introduction:Basic information about CAS 111060-63-0|(S)-2-CHLORO-1-(4-FLUOROPHENYL)ETHANOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-2-CHLORO-1-(4-FLUOROPHENYL)ETHANOL |
|---|
| CAS Number | 111060-63-0 | Molecular Weight | 253.33900 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C17H19NO | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | (s)-2-dibenzylamino-propionaldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C17H19NO |
|---|
| Molecular Weight | 253.33900 |
|---|
| Exact Mass | 253.14700 |
|---|
| PSA | 20.31000 |
|---|
| LogP | 3.27620 |
|---|
| InChIKey | GFYXFRCVQSKSDO-HNNXBMFYSA-N |
|---|
| SMILES | CC(C=O)N(Cc1ccccc1)Cc1ccccc1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H317 |
|---|
| Precautionary Statements | P280 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2922399090 |
|---|
Customs
| HS Code | 2922399090 |
|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| N,N-bis(phenylmethyl)acetamide |
| Essigsaeure-dibenzylamid |
| N,N-dibenzylalaninal |
| n-Acetyldibenzylamine |
| (S)-2-(dibenzylamino)propanal |
| (S)-(−)-2-(Dibenzylamino)propionaldehyde |
| N,N-dibenzyl-acetamide |
| Acetamide,N,N-dibenzyl |
| (S)-N,N-dibenzylalaninal |
| Acetyl-dibenzylamin |
| 1-(Propylsulfonyl)pyrrolidine |
| Dibenzylacetamide |
| (S)-2-(N,N-Dibenzylamino)-propionaldehyde |
| Acetamide,N,N-bis(phenylmethyl) |
| N,N-Dibenzyl-acetamid |
| (S)-2-(N,N-dibenzyl)aminopropanal |