Introduction：Basic information about CAS 67346-49-0|(R,R)-Formoterol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R,R)-Formoterol |
|---|
| CAS Number | 67346-49-0 | Molecular Weight | 344.405 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 603.2±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H24N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 318.6±31.5 °C |
|---|
Names
| Name | arformoterol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 603.2±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H24N2O4 |
|---|
| Molecular Weight | 344.405 |
|---|
| Flash Point | 318.6±31.5 °C |
|---|
| Exact Mass | 344.173615 |
|---|
| PSA | 90.82000 |
|---|
| LogP | 1.57 |
|---|
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | BPZSYCZIITTYBL-YJYMSZOUSA-N |
|---|
| SMILES | COc1ccc(CC(C)NCC(O)c2ccc(O)c(NC=O)c2)cc1 |
|---|
Synonyms
| N-{2-hydroxy-5-[(1R)-1-hydroxy-2-({(1R)-1-methyl-2-[4-(methyloxy)phenyl]ethyl}amino)ethyl]phenyl}formamide |
| Formamide, N-[2-hydroxy-5-[(1R)-1-hydroxy-2-[[(1R)-2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]phenyl]- |
| N-{2-Hydroxy-5-[(1R)-1-hydroxy-2-{[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino}ethyl]phenyl}formamide |
| Formoterol |
| N-{2-hydroxy-5-[(1R)-1-hydroxy-2-{[(1R)-2-(4-methoxyphenyl)-1-methylethyl]amino}ethyl]phenyl}formamide |
| (R,R)-Formoterol |
| N-{2-Hydroxy-5-[(1R)-1-hydroxy-2-{[(2R)-1-(4-methoxyphenyl)-2-propanyl]amino}ethyl]phenyl}formamide |
| Arformoterol |
