Introduction:Basic information about CAS 51760-21-5|Dimethyl 5-bromoisophthalate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dimethyl 5-bromoisophthalate |
|---|
| CAS Number | 51760-21-5 | Molecular Weight | 273.080 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 319.1±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H9BrO4 | Melting Point | 85-89 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 146.8±22.3 °C |
|---|
| Symbol | GHS06 | Signal Word | Danger |
|---|
Names
| Name | dimethyl 5-bromoisophthalate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 319.1±22.0 °C at 760 mmHg |
|---|
| Melting Point | 85-89 °C |
|---|
| Molecular Formula | C10H9BrO4 |
|---|
| Molecular Weight | 273.080 |
|---|
| Flash Point | 146.8±22.3 °C |
|---|
| Exact Mass | 271.968414 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 3.04 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | QUJINGKSNJNXEB-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(Br)cc(C(=O)OC)c1 |
|---|
Safety Information
| Symbol | GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301 |
|---|
| Precautionary Statements | P301 + P310 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|
| Hazard Codes | T,Xi |
|---|
| Risk Phrases | 25 |
|---|
| Safety Phrases | S45 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2917399090 |
|---|
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| MFCD00078709 |
| Dimethyl 5-bromoisophthalate |
| 5-BROMO-ISOPHTHALIC ACID DIMETHYL ESTER |
| 1,3-Benzenedicarboxylic acid, 5-bromo-, dimethyl ester |
| EINECS 257-386-0 |
| Dimethyl-5-bromoisophthalate |
| dimethyl 5-bromobenzene-1,3-dicarboxylate |
| 5-Bromoisophthalic Acid Dimethyl Ester |