Introduction：Basic information about CAS 306937-30-4|3-chloro-5-fluoro-2-methylbenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-chloro-5-fluoro-2-methylbenzenesulfonyl chloride |
|---|
| CAS Number | 306937-30-4 | Molecular Weight | 243.08300 |
|---|
| Density | 1.533g/cm3 | Boiling Point | 300.5ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5Cl2FO2S | Melting Point | 27-29ºC |
|---|
| MSDS | / | Flash Point | 135.6ºC |
|---|
Names
| Name | 3-chloro-5-fluoro-2-methylbenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.533g/cm3 |
|---|
| Boiling Point | 300.5ºC at 760 mmHg |
|---|
| Melting Point | 27-29ºC |
|---|
| Molecular Formula | C7H5Cl2FO2S |
|---|
| Molecular Weight | 243.08300 |
|---|
| Flash Point | 135.6ºC |
|---|
| Exact Mass | 241.93700 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 3.79580 |
|---|
| Index of Refraction | 1.542 |
|---|
| InChIKey | DPLPKJZEWFVGQM-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(Cl)cc(F)cc1S(=O)(=O)Cl |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 3261 |
|---|
Synonyms
| Benzenesulfonylchloride,3-chloro-5-fluoro-2-methyl |
| 3-Chloro-5-fluoro-2-methylbenzenesulfonylchloride |
