Introduction:Basic information about CAS 423-38-1|1,1,3,4-tetrachloro-1,2,2,3,4,4-hexafluorobutane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1,3,4-tetrachloro-1,2,2,3,4,4-hexafluorobutane |
|---|
| CAS Number | 423-38-1 | Molecular Weight | 303.84500 |
|---|
| Density | 1.736 | Boiling Point | 133ºC |
|---|
| Molecular Formula | C4Cl4F6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 49.1ºC |
|---|
Names
| Name | 1,1,3,4-tetrachloro-1,2,2,3,4,4-hexafluorobutane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.736 |
|---|
| Boiling Point | 133ºC |
|---|
| Molecular Formula | C4Cl4F6 |
|---|
| Molecular Weight | 303.84500 |
|---|
| Flash Point | 49.1ºC |
|---|
| Exact Mass | 301.86600 |
|---|
| LogP | 4.45880 |
|---|
| Vapour Pressure | 10.3mmHg at 25°C |
|---|
| Index of Refraction | 1.382 |
|---|
| InChIKey | CMVFABYKWZDQMC-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(Cl)C(F)(Cl)C(F)(F)C(F)(Cl)Cl |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S23-S26-S36 |
|---|
| HS Code | 2903799090 |
|---|
Customs
| HS Code | 2903799090 |
|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1,1,3,4-Tetrachlor-1,2,2,3,4,4-hexafluor-butan |
| 1,2,4,4-tetrachlorohexafluorobutane |
| 1,1,3,4-tetrachloro-1,2,2,3,4,4-hexafluoro-butane |
| Butane,1,1,3,4-tetrachlorohexafluoro |
| 1,1,3,4-Tetrachlorohexafluorobutane |
| Hexafluoro-1,1,3,4-tetrachlorobutane |
| Butane,1,1,3,4-tetrachloro-1,2,2,3,4,4-hexafluoro |
| 1,1,3,4-Tetrachlor-hexafluor-butan |
| PC4798 |