Introduction:Basic information about CAS 306935-64-8|1-(6-METHOXY-7-METHYL-6H-[1,2,5]OXADIAZOLO[3,4-E]INDOL-8-YL)ETHANONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(6-METHOXY-7-METHYL-6H-[1,2,5]OXADIAZOLO[3,4-E]INDOL-8-YL)ETHANONE |
|---|
| CAS Number | 306935-64-8 | Molecular Weight | 245.23400 |
|---|
| Density | 1.45g/cm3 | Boiling Point | 410.8ºC at 760mmHg |
|---|
| Molecular Formula | C12H11N3O3 | Melting Point | 201ºC |
|---|
| MSDS | / | Flash Point | 202.3ºC |
|---|
Names
| Name | 1-(6-methoxy-7-methylpyrrolo[2,3-g][2,1,3]benzoxadiazol-8-yl)ethanone |
|---|
Chemical & Physical Properties
| Density | 1.45g/cm3 |
|---|
| Boiling Point | 410.8ºC at 760mmHg |
|---|
| Melting Point | 201ºC |
|---|
| Molecular Formula | C12H11N3O3 |
|---|
| Molecular Weight | 245.23400 |
|---|
| Flash Point | 202.3ºC |
|---|
| Exact Mass | 245.08000 |
|---|
| PSA | 70.15000 |
|---|
| LogP | 1.74690 |
|---|
| Index of Refraction | 1.563 |
|---|
| InChIKey | LLPFLKKMWXCXOS-UHFFFAOYSA-N |
|---|
| SMILES | COn1c(C)c(C(C)=O)c2c3nonc3ccc21 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|