Introduction:Basic information about CAS 850156-39-7|2-chloro-3-(trifluoromethyl)benzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-chloro-3-(trifluoromethyl)benzoyl chloride |
|---|
| CAS Number | 850156-39-7 | Molecular Weight | 243.01000 |
|---|
| Density | 1.506g/cm3 | Boiling Point | 231.3ºC at 760 mmHg |
|---|
| Molecular Formula | C8H3Cl2F3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 93.7ºC |
|---|
Names
| Name | 2-chloro-3-(trifluoromethyl)benzoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.506g/cm3 |
|---|
| Boiling Point | 231.3ºC at 760 mmHg |
|---|
| Molecular Formula | C8H3Cl2F3O |
|---|
| Molecular Weight | 243.01000 |
|---|
| Flash Point | 93.7ºC |
|---|
| Exact Mass | 241.95100 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.73780 |
|---|
| Index of Refraction | 1.486 |
|---|
| InChIKey | PKEMXTIVOBWBNO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1cccc(C(F)(F)F)c1Cl |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| ZLD0242 |
| 2-chloro-3-trifluoromethylbenzoyl chloride |
| JRD-1285 |
| 2-chloro-3-trifluoromethylbenzoic acid chloride |