Introduction:Basic information about CAS 198220-53-0|4-(2,6-dimethylanilino)-4-oxobut-2-enoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2,6-dimethylanilino)-4-oxobut-2-enoic acid |
|---|
| CAS Number | 198220-53-0 | Molecular Weight | 219.23700 |
|---|
| Density | 1.243g/cm3 | Boiling Point | 436.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H13NO3 | Melting Point | 169ºC |
|---|
| MSDS | / | Flash Point | 217.6ºC |
|---|
Names
| Name | 4-(2,6-dimethylanilino)-4-oxobut-2-enoic acid |
|---|
Chemical & Physical Properties
| Density | 1.243g/cm3 |
|---|
| Boiling Point | 436.3ºC at 760 mmHg |
|---|
| Melting Point | 169ºC |
|---|
| Molecular Formula | C12H13NO3 |
|---|
| Molecular Weight | 219.23700 |
|---|
| Flash Point | 217.6ºC |
|---|
| Exact Mass | 219.09000 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 1.95570 |
|---|
| Vapour Pressure | 2.21E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | BDIUUKLMBSBKIT-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cccc(C)c1NC(=O)C=CC(=O)O |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|