CAS 2683-43-4|Benzenamine,2,4-dichloro-6-nitro-
Introduction：Basic information about CAS 2683-43-4|Benzenamine,2,4-dichloro-6-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenamine,2,4-dichloro-6-nitro- | ||
|---|---|---|---|
| CAS Number | 2683-43-4 | Molecular Weight | 207.01400 |
| Density | 1.624g/cm3 | Boiling Point | 307.5ºC at 760 mmHg |
| Molecular Formula | C6H4Cl2N2O2 | Melting Point | 101-103 °C(lit.) |
| MSDS | ChineseUSA | Flash Point | 139.8ºC |
| Symbol | GHS06, GHS08, GHS09 | Signal Word | Danger |
Names
| Name | 2,4-dichloro-6-nitroaniline |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.624g/cm3 |
|---|---|
| Boiling Point | 307.5ºC at 760 mmHg |
| Melting Point | 101-103 °C(lit.) |
| Molecular Formula | C6H4Cl2N2O2 |
| Molecular Weight | 207.01400 |
| Flash Point | 139.8ºC |
| Exact Mass | 205.96500 |
| PSA | 71.84000 |
| LogP | 3.58820 |
| Vapour Pressure | 0.00072mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | IZEZAMILKKYOPW-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cc(Cl)cc1[N+](=O)[O-] |
Safety Information
| Symbol | GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300 + H310 + H330-H373-H411 |
| Precautionary Statements | P260-P264-P273-P280-P284-P301 + P310 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S26-S37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2921420090 |
Customs
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
Articles2
More Articles| Substituent effects on the turn-on kinetics of rhodamine-based fluorescent pH probes. Org. Biomol. Chem. , (2013) Fluorescent turn-on probes based on a rhodamine spirolactam (RSL) structure have recently become a popular means of detecting pH, metal ions, and other analytes of interest. RSLs are colorless and non... | |
| [On the standardization of new chemical risk evaluation with eye irritation test]. Zhonghua Yu Fang Yi Xue Za Zhi 24(6) , 338-40, (1990) Three new chemicals, N-acyl glutamic acid as a stroma of cosmetics, an eye drops for myopia and 2, 4-dichloro-6-nitrophenylaminate (DCNP) as a new herbicide were evaluated with the eye irritation test... |
Synonyms
| 2,4,5-TRIFLUOROBENZENESULPHONAMIDE |
| 2-Nitro-4,6-dichloroaniline |
| 2,4-Dichloro-6-Nitro-Benzenamine |
| 2,4-dichloro-6-nitrophenylamine |
| EINECS 220-241-7 |
| 2,4-Dichloro-6-nitroaniline |
| 4,6-dichloro-2-nitrophenylamine |
| 2,4-Dichlor-6-nitro-anilin |
| 2,4-dichloro-6-nitro-aniline |
| 4,6-Dichloro-2-nitroaniline |
| MFCD00007664 |
