Introduction：Basic information about CAS 21731-56-6|4-(Methylsulfonyl)-2-nitroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(Methylsulfonyl)-2-nitroaniline |
|---|
| CAS Number | 21731-56-6 | Molecular Weight | 216.214 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 463.3±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H8N2O4S | Melting Point | 200-202ºC |
|---|
| MSDS | / | Flash Point | 234.0±28.7 °C |
|---|
Names
| Name | 4-methylsulfonyl-2-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 463.3±45.0 °C at 760 mmHg |
|---|
| Melting Point | 200-202ºC |
|---|
| Molecular Formula | C7H8N2O4S |
|---|
| Molecular Weight | 216.214 |
|---|
| Flash Point | 234.0±28.7 °C |
|---|
| Exact Mass | 216.020477 |
|---|
| PSA | 114.36000 |
|---|
| LogP | 1.04 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | NDZFWKZHVAUUTN-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)c1ccc(N)c([N+](=O)[O-])c1 |
|---|
Safety Information
Customs
| HS Code | 2921420090 |
|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-methylsulphonyl-2-nitroaniline |
| Benzenamine, 4-(methylsulfonyl)-2-nitro- |
| 4-methanesulfonyl-2-nitro-aniline |
| 4-(Methylsulfonyl)-2-nitroaniline |
| 4-Mesyl-2-nitroaniline |
| 2-nitro-4-methylsulphonylaniline |
| F0865-0001 |
| 1-Amino-4-methylsulphonyl-2-nitrobenzene |
| 4-Methansulfonyl-2-nitro-anilin |
