Introduction:Basic information about CAS 852228-17-2|2,5-dibromopyridine-3-boronic acid pinacol ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-dibromopyridine-3-boronic acid pinacol ester |
|---|
| CAS Number | 852228-17-2 | Molecular Weight | 380.86900 |
|---|
| Density | 1.645g/cm3 | Boiling Point | 430.714ºC at 760 mmHg |
|---|
| Molecular Formula | C11H16BBr2NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 214.288ºC |
|---|
Names
| Name | 2,5-dibromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.645g/cm3 |
|---|
| Boiling Point | 430.714ºC at 760 mmHg |
|---|
| Molecular Formula | C11H16BBr2NO3 |
|---|
| Molecular Weight | 380.86900 |
|---|
| Flash Point | 214.288ºC |
|---|
| Exact Mass | 378.95900 |
|---|
| PSA | 62.58000 |
|---|
| LogP | 1.86020 |
|---|
| Index of Refraction | 1.571 |
|---|
| InChIKey | KQFUAFHXDIYFFH-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)OB(c2cc(Br)cnc2Br)OC1(C)C |
|---|
Synonyms
| QC-9641 |
| 2,5-Dibromopyridine-3-boronic acid pinacol ester |