Introduction：Basic information about CAS 874459-62-8|2-Fluoro-4-ethoxycarbonylphenylboronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Fluoro-4-ethoxycarbonylphenylboronic acid |
|---|
| CAS Number | 874459-62-8 | Molecular Weight | 211.983 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 364.4±52.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H10BFO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 174.2±30.7 °C |
|---|
Names
| Name | 2-Fluoro-4-ethoxycarbonylphenylboronic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 364.4±52.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H10BFO4 |
|---|
| Molecular Weight | 211.983 |
|---|
| Flash Point | 174.2±30.7 °C |
|---|
| Exact Mass | 212.065613 |
|---|
| PSA | 66.76000 |
|---|
| LogP | 2.35 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.510 |
|---|
| InChIKey | HBXIRLABZXFDAX-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1ccc(B(O)O)c(F)c1 |
|---|
Synonyms
| (4-ethoxycarbonyl-2-fluorophenyl)boronic acid |
| [4-(Ethoxycarbonyl)-2-fluorophenyl]boronic acid |
| Benzoic acid, 4-borono-3-fluoro-, ethyl ester |
