Introduction:Basic information about CAS 15310-28-8|Bis-(toluene-4-sulfonyl)-methane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis-(toluene-4-sulfonyl)-methane |
|---|
| CAS Number | 15310-28-8 | Molecular Weight | 324.41500 |
|---|
| Density | 1.298g/cm3 | Boiling Point | 557.6ºC at 760mmHg |
|---|
| Molecular Formula | C15H16O4S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 367.2ºC |
|---|
Names
| Name | 1-methyl-4-[(4-methylphenyl)sulfonylmethylsulfonyl]benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.298g/cm3 |
|---|
| Boiling Point | 557.6ºC at 760mmHg |
|---|
| Molecular Formula | C15H16O4S2 |
|---|
| Molecular Weight | 324.41500 |
|---|
| Flash Point | 367.2ºC |
|---|
| Exact Mass | 324.04900 |
|---|
| PSA | 85.04000 |
|---|
| LogP | 4.67010 |
|---|
| Vapour Pressure | 6.78E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | XLOXYWLRAKCDQL-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)CS(=O)(=O)c2ccc(C)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2904100000 |
|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| Bis-(toluene-4-sulfonyl)-methane |
| bis-(p-tolysulfonyl)methane |
| bis-(toluene-p-sulfonyl)methane |
| bis(p-tolylsulphonyl)methane |
| bis(tolylsulfonyl)methane |
| 1,1'-(methanediyldisulfonyl)bis(4-methylbenzene) |
| Bis-(toluene-4-sulfonyl)methane |
| Bis-(toluol-4-sulfonyl)-methan |