Introduction：Basic information about CAS 30710-21-5|Benzothiazole,2-hydrazinyl-6-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzothiazole,2-hydrazinyl-6-nitro- |
|---|
| CAS Number | 30710-21-5 | Molecular Weight | 210.21300 |
|---|
| Density | 1.685g/cm3 | Boiling Point | 425.2ºC at 760 mmHg |
|---|
| Molecular Formula | C7H6N4O2S | Melting Point | 273-274ºC |
|---|
| MSDS | / | Flash Point | 211ºC |
|---|
Names
| Name | (6-nitro-1,3-benzothiazol-2-yl)hydrazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.685g/cm3 |
|---|
| Boiling Point | 425.2ºC at 760 mmHg |
|---|
| Melting Point | 273-274ºC |
|---|
| Molecular Formula | C7H6N4O2S |
|---|
| Molecular Weight | 210.21300 |
|---|
| Flash Point | 211ºC |
|---|
| Exact Mass | 210.02100 |
|---|
| PSA | 125.00000 |
|---|
| LogP | 2.78660 |
|---|
| Index of Refraction | 1.848 |
|---|
| InChIKey | HCIQJRCGPLSQLH-UHFFFAOYSA-N |
|---|
| SMILES | NNc1nc2ccc([N+](=O)[O-])cc2s1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2934200090 |
|---|
Customs
| HS Code | 2934200090 |
|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-hydrazino-6-nitro-benzothiazole |
| Benzothiazole,2-hydrazinyl-6-nitro |
| 2-hydrazino-6-nitro-1,3-benzothiazole |
| 2-Hydrazino-6-nitro-benzothiazol |
| 6-nitrobenzothiazole-2-ylhydrazine |
| 6-Nitro-benzthiazolyl-(2)-hydrazin |
| 6-nitro-2-hydrazino benzothiazole |
| hydrazinonitrobenzothiazole |
| 6-Nitro-2-hydrazino-benzothiazol |
