Introduction:Basic information about CAS 307-29-9|1H,1H-Perfluorooctylamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H,1H-Perfluorooctylamine |
|---|
| CAS Number | 307-29-9 | Molecular Weight | 399.10000 |
|---|
| Density | 1,714 g/cm3 | Boiling Point | 75 °C |
|---|
| Molecular Formula | C8H4F15N | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 75°C/50mm |
|---|
Names
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1,714 g/cm3 |
|---|
| Boiling Point | 75 °C |
|---|
| Molecular Formula | C8H4F15N |
|---|
| Molecular Weight | 399.10000 |
|---|
| Flash Point | 75°C/50mm |
|---|
| Exact Mass | 399.01000 |
|---|
| PSA | 26.02000 |
|---|
| LogP | 5.01950 |
|---|
| Index of Refraction | 1.305 |
|---|
| InChIKey | HZCZXRSVKNFILZ-UHFFFAOYSA-N |
|---|
| SMILES | NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| RIDADR | UN2735 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2921199090 |
|---|
Customs
| HS Code | 2921199090 |
|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| PC5396 |
| MFCD00042460 |
| 1H,1H-Pentadecafluorooctylamine |
| 1H,1H-perfluorooctylamine |
| 1H-pentadecafluorooctylamine |
| N-1,1-H-perfluorooctyl amine |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-octylamine |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluor-octylamin |