Introduction：Basic information about CAS 30459-17-7|1-(4-Trifluoromethylphenyl)piperazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-Trifluoromethylphenyl)piperazine |
|---|
| CAS Number | 30459-17-7 | Molecular Weight | 230.230 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 309.1±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H13F3N2 | Melting Point | 88-92 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 140.7±27.9 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 1-[4-(trifluoromethyl)phenyl]piperazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 309.1±42.0 °C at 760 mmHg |
|---|
| Melting Point | 88-92 °C |
|---|
| Molecular Formula | C11H13F3N2 |
|---|
| Molecular Weight | 230.230 |
|---|
| Flash Point | 140.7±27.9 °C |
|---|
| Exact Mass | 230.103088 |
|---|
| PSA | 15.27000 |
|---|
| LogP | 2.36 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.485 |
|---|
| InChIKey | IBQMAPSJLHRQPE-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1ccc(N2CCNCC2)cc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant;C: Corrosive; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-(4-Trifluoromethylphenyl)-piperazine |
| N-(alpha,alpha,alpha-Trifluoro-p-tolyl)piperazine |
| 1-(α,α,α-Trifluoro-m-tolyl)piperazine |
| EINECS 250-210-3 |
| 4-(1-Piperazinyl)benzotrifluoride |
| 1-(4-Trifluoromethylphenyl)piperazine |
| 1-(3-Trifluoromethylphenyl)piperazine |
| Piperazine, 1-[4-(trifluoromethyl)phenyl]- |
| 1-(4-Trifluoromethyl-phenyl)-piperazine |
| piperazine, 1-(4-trifluoromethylphenyl)- |
| 1-[4-(Trifluoromethyl)phenyl]piperazine |
| 1-(4-(Trifluoromethyl)phenyl)piperazine |
| 1-(3-(trifluoromethyl)phenyl)piperazine |
| 1-(α,α,α-Trifluoro-p-tolyl)piperazine |
| 1-[3-(Trifluoromethyl)phenyl]piperazine |
| MFCD00040765 |
| Piperazine, 1-[3-(trifluoromethyl)phenyl]- |
| [4-(trifluoromethyl)phenyl]piperazine |
| TFMPP |
