Introduction：Basic information about CAS 423-95-0|9h-hexadecafluorononanoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9h-hexadecafluorononanoyl chloride |
|---|
| CAS Number | 423-95-0 | Molecular Weight | 464.53100 |
|---|
| Density | 1,803 g/cm3 | Boiling Point | 166 °C |
|---|
| Molecular Formula | C9HClF16O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 58.8ºC |
|---|
Names
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1,803 g/cm3 |
|---|
| Boiling Point | 166 °C |
|---|
| Molecular Formula | C9HClF16O |
|---|
| Molecular Weight | 464.53100 |
|---|
| Flash Point | 58.8ºC |
|---|
| Exact Mass | 463.94600 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 5.46400 |
|---|
| Vapour Pressure | 1.26mmHg at 25°C |
|---|
| Index of Refraction | 1.322 |
|---|
| InChIKey | RJYUFWDUKZUCSP-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| RIDADR | 3265 |
|---|
| HS Code | 2915900090 |
|---|
Customs
| HS Code | 2915900090 |
|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| EINECS 207-033-1 |
| Hexadecafluor-9H-nonansaeurechlorid |
| 9h-perfluorononanoyl chloride |
| MFCD00042120 |
| 9H-Hexadecafluor-nonanoylchlorid |
| 9H-Hexadecafluorononanoyl chloride |
| PC4532 |
